C33H35N3O — CID 164823336
1-[(1S,3S)-3-propyl-1-[4-(1-tetracyclo[5.2.1.03,8.05,8]decanylamino)phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]prop-2-yn-1-one (PubChem CID 164823336) has the molecular formula C33H35N3O and a molecular weight of 489.66 g/mol. Its IUPAC name is 1-[(1S,3S)-3-propyl-1-[4-(1-tetracyclo[5.2.1.03,8.05,8]decanylamino)phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]prop-2-yn-1-one.
| Compound Name | 1-[(1S,3S)-3-propyl-1-[4-(1-tetracyclo[5.2.1.03,8.05,8]decanylamino)phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]prop-2-yn-1-one |
|---|---|
| PubChem CID | 164823336 |
| Molecular Formula | C33H35N3O |
| Molecular Weight | 489.66 g/mol |
| Exact Mass | 489.28 |
| IUPAC Name | 1-[(1S,3S)-3-propyl-1-[4-(1-tetracyclo[5.2.1.03,8.05,8]decanylamino)phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]prop-2-yn-1-one |
| SMILES | C#CC(=O)N1[C@@H](CCC)Cc2c([nH]c3ccccc23)[C@@H]1c1ccc(NC23CC4CC5CC(C2)C54C3)cc1 |
| InChI | InChI=1S/C33H35N3O/c1-3-7-25-16-27-26-8-5-6-9-28(26)34-30(27)31(36(25)29(37)4-2)20-10-12-24(13-11-20)35-32-17-22-14-21-15-23(18-32)33(21,22)19-32/h2,5-6,8-13,21-23,25,31,34-35H,3,7,14-19H2,1H3/t21?,22?,23?,25-,31-,32?,33?/m0/s1 |
| InChIKey | VCILZTCBYQUAAJ-ABRNTCEKSA-N |
| XLogP | 6.43 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.66 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|