C29H36N3Pb — CID 156644968
CID 156644968 (PubChem CID 156644968) has the molecular formula C29H36N3Pb and a molecular weight of 633.83 g/mol.
| Compound Name | CID 156644968 |
|---|---|
| PubChem CID | 156644968 |
| Molecular Formula | C29H36N3Pb |
| Molecular Weight | 633.83 g/mol |
| Exact Mass | 634.27 |
| IUPAC Name | — |
| SMILES | CC1CC2CC(C)CC(Nc3ccc(C4c5[nH]c6ccccc6c5CCN4C[Pb])cc3)(C1)C2 |
| InChI | InChI=1S/C29H36N3.Pb/c1-19-14-21-15-20(2)17-29(16-19,18-21)31-23-10-8-22(9-11-23)28-27-25(12-13-32(28)3)24-6-4-5-7-26(24)30-27;/h4-11,19-21,28,30-31H,3,12-18H2,1-2H3; |
| InChIKey | GIDOAXAHFIIJKQ-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 31.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.83 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|