C27H32N4 — CID 167072875
N-[4-[(1R)-2-but-3-enyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenyl]-1-prop-2-enylazetidin-3-amine (PubChem CID 167072875) has the molecular formula C27H32N4 and a molecular weight of 412.58 g/mol. Its IUPAC name is N-[4-[(1R)-2-but-3-enyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenyl]-1-prop-2-enylazetidin-3-amine.
| Compound Name | N-[4-[(1R)-2-but-3-enyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenyl]-1-prop-2-enylazetidin-3-amine |
|---|---|
| PubChem CID | 167072875 |
| Molecular Formula | C27H32N4 |
| Molecular Weight | 412.58 g/mol |
| Exact Mass | 412.26 |
| IUPAC Name | N-[4-[(1R)-2-but-3-enyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenyl]-1-prop-2-enylazetidin-3-amine |
| SMILES | C=CCCN1CCc2c([nH]c3ccccc23)[C@H]1c1ccc(NC2CN(CC=C)C2)cc1 |
| InChI | InChI=1S/C27H32N4/c1-3-5-16-31-17-14-24-23-8-6-7-9-25(23)29-26(24)27(31)20-10-12-21(13-11-20)28-22-18-30(19-22)15-4-2/h3-4,6-13,22,27-29H,1-2,5,14-19H2/t27-/m1/s1 |
| InChIKey | IFPCIAOWQVBPNT-HHHXNRCGSA-N |
| XLogP | 4.97 |
| TPSA | 34.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.58 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|