C20H20BrN3 — CID 164561440
1-(5-bromo-2-pyridinyl)-2-but-3-enyl-1,3,4,9-tetrahydropyrido[3,4-b]indole (PubChem CID 164561440) has the molecular formula C20H20BrN3 and a molecular weight of 382.31 g/mol. Its IUPAC name is 1-(5-bromo-2-pyridinyl)-2-but-3-enyl-1,3,4,9-tetrahydropyrido[3,4-b]indole.
| Compound Name | 1-(5-bromo-2-pyridinyl)-2-but-3-enyl-1,3,4,9-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 164561440 |
| Molecular Formula | C20H20BrN3 |
| Molecular Weight | 382.31 g/mol |
| Exact Mass | 381.08 |
| IUPAC Name | 1-(5-bromo-2-pyridinyl)-2-but-3-enyl-1,3,4,9-tetrahydropyrido[3,4-b]indole |
| SMILES | C=CCCN1CCc2c([nH]c3ccccc23)C1c1ccc(Br)cn1 |
| InChI | InChI=1S/C20H20BrN3/c1-2-3-11-24-12-10-16-15-6-4-5-7-17(15)23-19(16)20(24)18-9-8-14(21)13-22-18/h2,4-9,13,20,23H,1,3,10-12H2 |
| InChIKey | RMUAGFQENGYYQS-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.31 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|