C23H22N4OS — CID 45203532
N-[5-[(1-pyridin-2-yl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)methyl]thiophen-2-yl]acetamide (PubChem CID 45203532) has the molecular formula C23H22N4OS and a molecular weight of 402.52 g/mol. Its IUPAC name is N-[5-[(1-pyridin-2-yl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)methyl]thiophen-2-yl]acetamide.
| Compound Name | N-[5-[(1-pyridin-2-yl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)methyl]thiophen-2-yl]acetamide |
|---|---|
| PubChem CID | 45203532 |
| Molecular Formula | C23H22N4OS |
| Molecular Weight | 402.52 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | N-[5-[(1-pyridin-2-yl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)methyl]thiophen-2-yl]acetamide |
| SMILES | CC(=O)Nc1ccc(CN2CCc3c([nH]c4ccccc34)C2c2ccccn2)s1 |
| InChI | InChI=1S/C23H22N4OS/c1-15(28)25-21-10-9-16(29-21)14-27-13-11-18-17-6-2-3-7-19(17)26-22(18)23(27)20-8-4-5-12-24-20/h2-10,12,23,26H,11,13-14H2,1H3,(H,25,28) |
| InChIKey | XFPJIZFSFDPUIG-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.52 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|