C26H22N6O — CID 45177468
2-(3-phenyl-1H-1,2,4-triazol-5-yl)-1-(1-pyridin-2-yl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)ethanone (PubChem CID 45177468) has the molecular formula C26H22N6O and a molecular weight of 434.50 g/mol. Its IUPAC name is 2-(3-phenyl-1H-1,2,4-triazol-5-yl)-1-(1-pyridin-2-yl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)ethanone.
| Compound Name | 2-(3-phenyl-1H-1,2,4-triazol-5-yl)-1-(1-pyridin-2-yl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)ethanone |
|---|---|
| PubChem CID | 45177468 |
| Molecular Formula | C26H22N6O |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.19 |
| IUPAC Name | 2-(3-phenyl-1H-1,2,4-triazol-5-yl)-1-(1-pyridin-2-yl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)ethanone |
| SMILES | O=C(Cc1nc(-c2ccccc2)n[nH]1)N1CCc2c([nH]c3ccccc23)C1c1ccccn1 |
| InChI | InChI=1S/C26H22N6O/c33-23(16-22-29-26(31-30-22)17-8-2-1-3-9-17)32-15-13-19-18-10-4-5-11-20(18)28-24(19)25(32)21-12-6-7-14-27-21/h1-12,14,25,28H,13,15-16H2,(H,29,30,31) |
| InChIKey | SSNKWVDIFMEUJY-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 90.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|