C25H19N3O — CID 25289535
3-phenyl-1-[(1S)-1-pyridin-2-yl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]prop-2-yn-1-one (PubChem CID 25289535) has the molecular formula C25H19N3O and a molecular weight of 377.45 g/mol. Its IUPAC name is 3-phenyl-1-[(1S)-1-pyridin-2-yl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]prop-2-yn-1-one.
| Compound Name | 3-phenyl-1-[(1S)-1-pyridin-2-yl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]prop-2-yn-1-one |
|---|---|
| PubChem CID | 25289535 |
| Molecular Formula | C25H19N3O |
| Molecular Weight | 377.45 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | 3-phenyl-1-[(1S)-1-pyridin-2-yl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]prop-2-yn-1-one |
| SMILES | O=C(C#Cc1ccccc1)N1CCc2c([nH]c3ccccc23)[C@H]1c1ccccn1 |
| InChI | InChI=1S/C25H19N3O/c29-23(14-13-18-8-2-1-3-9-18)28-17-15-20-19-10-4-5-11-21(19)27-24(20)25(28)22-12-6-7-16-26-22/h1-12,16,25,27H,15,17H2/t25-/m1/s1 |
| InChIKey | DDXFGWGXYOXIKS-RUZDIDTESA-N |
| XLogP | 4.09 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.45 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|