C22H23N3 — CID 167105943
(1S)-2-[(3E)-3-methylpenta-1,3-dien-2-yl]-1-pyridin-2-yl-1,3,4,9-tetrahydropyrido[3,4-b]indole (PubChem CID 167105943) has the molecular formula C22H23N3 and a molecular weight of 329.45 g/mol. Its IUPAC name is (1S)-2-[(3E)-3-methylpenta-1,3-dien-2-yl]-1-pyridin-2-yl-1,3,4,9-tetrahydropyrido[3,4-b]indole.
| Compound Name | (1S)-2-[(3E)-3-methylpenta-1,3-dien-2-yl]-1-pyridin-2-yl-1,3,4,9-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 167105943 |
| Molecular Formula | C22H23N3 |
| Molecular Weight | 329.45 g/mol |
| Exact Mass | 329.19 |
| IUPAC Name | (1S)-2-[(3E)-3-methylpenta-1,3-dien-2-yl]-1-pyridin-2-yl-1,3,4,9-tetrahydropyrido[3,4-b]indole |
| SMILES | C=C(/C(C)=C/C)N1CCc2c([nH]c3ccccc23)[C@H]1c1ccccn1 |
| InChI | InChI=1S/C22H23N3/c1-4-15(2)16(3)25-14-12-18-17-9-5-6-10-19(17)24-21(18)22(25)20-11-7-8-13-23-20/h4-11,13,22,24H,3,12,14H2,1-2H3/b15-4+/t22-/m1/s1 |
| InChIKey | RDTCACRRNBBFAZ-NJJUKYCXSA-N |
| XLogP | 4.99 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.45 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|