C20H24N4O2S — CID 97276849
(1S)-N,N-diethyl-1-pyridin-2-yl-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-sulfonamide (PubChem CID 97276849) has the molecular formula C20H24N4O2S and a molecular weight of 384.51 g/mol. Its IUPAC name is (1S)-N,N-diethyl-1-pyridin-2-yl-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-sulfonamide.
| Compound Name | (1S)-N,N-diethyl-1-pyridin-2-yl-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-sulfonamide |
|---|---|
| PubChem CID | 97276849 |
| Molecular Formula | C20H24N4O2S |
| Molecular Weight | 384.51 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | (1S)-N,N-diethyl-1-pyridin-2-yl-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-sulfonamide |
| SMILES | CCN(CC)S(=O)(=O)N1CCc2c([nH]c3ccccc23)[C@H]1c1ccccn1 |
| InChI | InChI=1S/C20H24N4O2S/c1-3-23(4-2)27(25,26)24-14-12-16-15-9-5-6-10-17(15)22-19(16)20(24)18-11-7-8-13-21-18/h5-11,13,20,22H,3-4,12,14H2,1-2H3/t20-/m1/s1 |
| InChIKey | SVVOLXCCERDUEM-HXUWFJFHSA-N |
| XLogP | 3.10 |
| TPSA | 69.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.51 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|