C26H34N6 — CID 167072866
5-[(1S)-2-but-3-enyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-N-[(3S)-1-propylpyrrolidin-3-yl]pyrazin-2-amine (PubChem CID 167072866) has the molecular formula C26H34N6 and a molecular weight of 430.60 g/mol. Its IUPAC name is 5-[(1S)-2-but-3-enyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-N-[(3S)-1-propylpyrrolidin-3-yl]pyrazin-2-amine.
| Compound Name | 5-[(1S)-2-but-3-enyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-N-[(3S)-1-propylpyrrolidin-3-yl]pyrazin-2-amine |
|---|---|
| PubChem CID | 167072866 |
| Molecular Formula | C26H34N6 |
| Molecular Weight | 430.60 g/mol |
| Exact Mass | 430.28 |
| IUPAC Name | 5-[(1S)-2-but-3-enyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-N-[(3S)-1-propylpyrrolidin-3-yl]pyrazin-2-amine |
| SMILES | C=CCCN1CCc2c([nH]c3ccccc23)[C@H]1c1cnc(N[C@H]2CCN(CCC)C2)cn1 |
| InChI | InChI=1S/C26H34N6/c1-3-5-13-32-15-11-21-20-8-6-7-9-22(20)30-25(21)26(32)23-16-28-24(17-27-23)29-19-10-14-31(18-19)12-4-2/h3,6-9,16-17,19,26,30H,1,4-5,10-15,18H2,2H3,(H,28,29)/t19-,26+/m0/s1 |
| InChIKey | KHVYHNAVOVJHDP-AFMDSPMNSA-N |
| XLogP | 4.38 |
| TPSA | 60.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.60 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|