C30H40N6 — CID 164561341
5-[(1S,3R)-2-(2-bicyclo[3.1.1]heptanyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-N-[(3S)-1-propylpyrrolidin-3-yl]pyrazin-2-amine (PubChem CID 164561341) has the molecular formula C30H40N6 and a molecular weight of 484.69 g/mol. Its IUPAC name is 5-[(1S,3R)-2-(2-bicyclo[3.1.1]heptanyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-N-[(3S)-1-propylpyrrolidin-3-yl]pyrazin-2-amine.
| Compound Name | 5-[(1S,3R)-2-(2-bicyclo[3.1.1]heptanyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-N-[(3S)-1-propylpyrrolidin-3-yl]pyrazin-2-amine |
|---|---|
| PubChem CID | 164561341 |
| Molecular Formula | C30H40N6 |
| Molecular Weight | 484.69 g/mol |
| Exact Mass | 484.33 |
| IUPAC Name | 5-[(1S,3R)-2-(2-bicyclo[3.1.1]heptanyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-N-[(3S)-1-propylpyrrolidin-3-yl]pyrazin-2-amine |
| SMILES | CCCN1CC[C@H](Nc2cnc([C@@H]3c4[nH]c5ccccc5c4C[C@@H](C)N3C3CCC4CC3C4)cn2)C1 |
| InChI | InChI=1S/C30H40N6/c1-3-11-35-12-10-22(18-35)33-28-17-31-26(16-32-28)30-29-24(23-6-4-5-7-25(23)34-29)13-19(2)36(30)27-9-8-20-14-21(27)15-20/h4-7,16-17,19-22,27,30,34H,3,8-15,18H2,1-2H3,(H,32,33)/t19-,20?,21?,22+,27?,30-/m1/s1 |
| InChIKey | URQJZHDTUKDRQW-NFUQBHTKSA-N |
| XLogP | 5.38 |
| TPSA | 60.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.69 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|