C28H36N6 — CID 164561430
5-[(1S,3R)-2-(1-bicyclo[1.1.1]pentanyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-N-[(3S)-1-propylpyrrolidin-3-yl]pyrazin-2-amine (PubChem CID 164561430) has the molecular formula C28H36N6 and a molecular weight of 456.64 g/mol. Its IUPAC name is 5-[(1S,3R)-2-(1-bicyclo[1.1.1]pentanyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-N-[(3S)-1-propylpyrrolidin-3-yl]pyrazin-2-amine.
| Compound Name | 5-[(1S,3R)-2-(1-bicyclo[1.1.1]pentanyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-N-[(3S)-1-propylpyrrolidin-3-yl]pyrazin-2-amine |
|---|---|
| PubChem CID | 164561430 |
| Molecular Formula | C28H36N6 |
| Molecular Weight | 456.64 g/mol |
| Exact Mass | 456.30 |
| IUPAC Name | 5-[(1S,3R)-2-(1-bicyclo[1.1.1]pentanyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-N-[(3S)-1-propylpyrrolidin-3-yl]pyrazin-2-amine |
| SMILES | CCCN1CC[C@H](Nc2cnc([C@@H]3c4[nH]c5ccccc5c4C[C@@H](C)N3C34CC(C3)C4)cn2)C1 |
| InChI | InChI=1S/C28H36N6/c1-3-9-33-10-8-20(17-33)31-25-16-29-24(15-30-25)27-26-22(21-6-4-5-7-23(21)32-26)11-18(2)34(27)28-12-19(13-28)14-28/h4-7,15-16,18-20,27,32H,3,8-14,17H2,1-2H3,(H,30,31)/t18-,19?,20+,27-,28?/m1/s1 |
| InChIKey | MJNKKCLYQFSUJZ-XWDOHHGLSA-N |
| XLogP | 4.74 |
| TPSA | 60.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.64 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|