C30H36FN3O2 — CID 164561233
(3R,4R)-4-[4-[(1R,3R)-2-(1-bicyclo[1.1.1]pentanyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenoxy]-1-(3-fluoropropyl)pyrrolidin-3-ol (PubChem CID 164561233) has the molecular formula C30H36FN3O2 and a molecular weight of 489.64 g/mol. Its IUPAC name is (3R,4R)-4-[4-[(1R,3R)-2-(1-bicyclo[1.1.1]pentanyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenoxy]-1-(3-fluoropropyl)pyrrolidin-3-ol.
| Compound Name | (3R,4R)-4-[4-[(1R,3R)-2-(1-bicyclo[1.1.1]pentanyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenoxy]-1-(3-fluoropropyl)pyrrolidin-3-ol |
|---|---|
| PubChem CID | 164561233 |
| Molecular Formula | C30H36FN3O2 |
| Molecular Weight | 489.64 g/mol |
| Exact Mass | 489.28 |
| IUPAC Name | (3R,4R)-4-[4-[(1R,3R)-2-(1-bicyclo[1.1.1]pentanyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenoxy]-1-(3-fluoropropyl)pyrrolidin-3-ol |
| SMILES | C[C@@H]1Cc2c([nH]c3ccccc23)[C@@H](c2ccc(O[C@@H]3CN(CCCF)C[C@H]3O)cc2)N1C12CC(C1)C2 |
| InChI | InChI=1S/C30H36FN3O2/c1-19-13-24-23-5-2-3-6-25(23)32-28(24)29(34(19)30-14-20(15-30)16-30)21-7-9-22(10-8-21)36-27-18-33(12-4-11-31)17-26(27)35/h2-3,5-10,19-20,26-27,29,32,35H,4,11-18H2,1H3/t19-,20?,26-,27-,29-,30?/m1/s1 |
| InChIKey | VBRJWVXYPTYYSE-LCWYLHMZSA-N |
| XLogP | 4.84 |
| TPSA | 51.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.64 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|