C30H39FN4O — CID 167072857
[(3R)-1-(3-fluoropropyl)pyrrolidin-3-yl] (2Z)-4-[(1R,3R)-2-(1-bicyclo[1.1.1]pentanyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-N-methylpenta-2,4-dienimidate (PubChem CID 167072857) has the molecular formula C30H39FN4O and a molecular weight of 490.67 g/mol. Its IUPAC name is [(3R)-1-(3-fluoropropyl)pyrrolidin-3-yl] (2Z)-4-[(1R,3R)-2-(1-bicyclo[1.1.1]pentanyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-N-methylpenta-2,4-dienimidate.
| Compound Name | [(3R)-1-(3-fluoropropyl)pyrrolidin-3-yl] (2Z)-4-[(1R,3R)-2-(1-bicyclo[1.1.1]pentanyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-N-methylpenta-2,4-dienimidate |
|---|---|
| PubChem CID | 167072857 |
| Molecular Formula | C30H39FN4O |
| Molecular Weight | 490.67 g/mol |
| Exact Mass | 490.31 |
| IUPAC Name | [(3R)-1-(3-fluoropropyl)pyrrolidin-3-yl] (2Z)-4-[(1R,3R)-2-(1-bicyclo[1.1.1]pentanyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-N-methylpenta-2,4-dienimidate |
| SMILES | C=C(/C=C\C(=N\C)O[C@@H]1CCN(CCCF)C1)[C@@H]1c2[nH]c3ccccc3c2C[C@@H](C)N1C12CC(C1)C2 |
| InChI | InChI=1S/C30H39FN4O/c1-20(9-10-27(32-3)36-23-11-14-34(19-23)13-6-12-31)29-28-25(24-7-4-5-8-26(24)33-28)15-21(2)35(29)30-16-22(17-30)18-30/h4-5,7-10,21-23,29,33H,1,6,11-19H2,2-3H3/b10-9-,32-27-/t21-,22?,23-,29-,30?/m1/s1 |
| InChIKey | AVDUCXJODROSQQ-HSYHHRCZSA-N |
| XLogP | 5.60 |
| TPSA | 43.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.67 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|