C30H37FN4O — CID 167141474
(1R,3R)-2-(1-bicyclo[2.1.1]hexanyl)-1-[6-[(3S)-1-(3-fluoropropyl)pyrrolidin-3-yl]oxy-3-pyridinyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole (PubChem CID 167141474) has the molecular formula C30H37FN4O and a molecular weight of 488.65 g/mol. Its IUPAC name is (1R,3R)-2-(1-bicyclo[2.1.1]hexanyl)-1-[6-[(3S)-1-(3-fluoropropyl)pyrrolidin-3-yl]oxy-3-pyridinyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole.
| Compound Name | (1R,3R)-2-(1-bicyclo[2.1.1]hexanyl)-1-[6-[(3S)-1-(3-fluoropropyl)pyrrolidin-3-yl]oxy-3-pyridinyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 167141474 |
| Molecular Formula | C30H37FN4O |
| Molecular Weight | 488.65 g/mol |
| Exact Mass | 488.30 |
| IUPAC Name | (1R,3R)-2-(1-bicyclo[2.1.1]hexanyl)-1-[6-[(3S)-1-(3-fluoropropyl)pyrrolidin-3-yl]oxy-3-pyridinyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole |
| SMILES | C[C@@H]1Cc2c([nH]c3ccccc23)[C@@H](c2ccc(O[C@H]3CCN(CCCF)C3)nc2)N1C12CCC(C1)C2 |
| InChI | InChI=1S/C30H37FN4O/c1-20-15-25-24-5-2-3-6-26(24)33-28(25)29(35(20)30-11-9-21(16-30)17-30)22-7-8-27(32-18-22)36-23-10-14-34(19-23)13-4-12-31/h2-3,5-8,18,20-21,23,29,33H,4,9-17,19H2,1H3/t20-,21?,23+,29-,30?/m1/s1 |
| InChIKey | JUOXCKDCMUZOPY-DRDROIEQSA-N |
| XLogP | 5.65 |
| TPSA | 44.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.65 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|