C31H32F2N4O — CID 167072895
(3R,14R)-16-fluoro-18-[1-(3-fluoropropyl)pyrrolidin-3-yl]oxy-3-methyl-2,12-diazaheptacyclo[20.1.1.01,21.02,14.05,13.06,11.015,20]tetracosa-5(13),6,8,10,15(20),16,18-heptaene-22-carbonitrile (PubChem CID 167072895) has the molecular formula C31H32F2N4O and a molecular weight of 514.62 g/mol. Its IUPAC name is (3R,14R)-16-fluoro-18-[1-(3-fluoropropyl)pyrrolidin-3-yl]oxy-3-methyl-2,12-diazaheptacyclo[20.1.1.01,21.02,14.05,13.06,11.015,20]tetracosa-5(13),6,8,10,15(20),16,18-heptaene-22-carbonitrile.
| Compound Name | (3R,14R)-16-fluoro-18-[1-(3-fluoropropyl)pyrrolidin-3-yl]oxy-3-methyl-2,12-diazaheptacyclo[20.1.1.01,21.02,14.05,13.06,11.015,20]tetracosa-5(13),6,8,10,15(20),16,18-heptaene-22-carbonitrile |
|---|---|
| PubChem CID | 167072895 |
| Molecular Formula | C31H32F2N4O |
| Molecular Weight | 514.62 g/mol |
| Exact Mass | 514.25 |
| IUPAC Name | (3R,14R)-16-fluoro-18-[1-(3-fluoropropyl)pyrrolidin-3-yl]oxy-3-methyl-2,12-diazaheptacyclo[20.1.1.01,21.02,14.05,13.06,11.015,20]tetracosa-5(13),6,8,10,15(20),16,18-heptaene-22-carbonitrile |
| SMILES | C[C@@H]1Cc2c([nH]c3ccccc23)[C@H]2c3c(F)cc(OC4CCN(CCCF)C4)cc3C3C4(C#N)CC3(C4)N21 |
| InChI | InChI=1S/C31H32F2N4O/c1-18-11-22-21-5-2-3-6-25(21)35-27(22)28-26-23(29-30(17-34)15-31(29,16-30)37(18)28)12-20(13-24(26)33)38-19-7-10-36(14-19)9-4-8-32/h2-3,5-6,12-13,18-19,28-29,35H,4,7-11,14-16H2,1H3/t18-,19?,28-,29?,30?,31?/m1/s1 |
| InChIKey | XGYKSNKKQYXMPG-UEDATTPGSA-N |
| XLogP | 5.61 |
| TPSA | 55.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.62 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|