C30H33F3N4O — CID 164561317
3-[(1R,3R)-1-[2-fluoro-4-[1-(3-fluoropropyl)pyrrolidin-3-yl]oxyphenyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]cyclobuta-1,2-diene-1-carbonitrile;molecular hydrogen;hydrofluoride (PubChem CID 164561317) has the molecular formula C30H33F3N4O and a molecular weight of 522.62 g/mol. Its IUPAC name is 3-[(1R,3R)-1-[2-fluoro-4-[1-(3-fluoropropyl)pyrrolidin-3-yl]oxyphenyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]cyclobuta-1,2-diene-1-carbonitrile;molecular hydrogen;hydrofluoride.
| Compound Name | 3-[(1R,3R)-1-[2-fluoro-4-[1-(3-fluoropropyl)pyrrolidin-3-yl]oxyphenyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]cyclobuta-1,2-diene-1-carbonitrile;molecular hydrogen;hydrofluoride |
|---|---|
| PubChem CID | 164561317 |
| Molecular Formula | C30H33F3N4O |
| Molecular Weight | 522.62 g/mol |
| Exact Mass | 522.26 |
| IUPAC Name | 3-[(1R,3R)-1-[2-fluoro-4-[1-(3-fluoropropyl)pyrrolidin-3-yl]oxyphenyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]cyclobuta-1,2-diene-1-carbonitrile;molecular hydrogen;hydrofluoride |
| SMILES | C[C@@H]1Cc2c([nH]c3ccccc23)[C@@H](c2ccc(OC3CCN(CCCF)C3)cc2F)N1C1=C=C(C#N)C1.F.[H][H] |
| InChI | InChI=1S/C30H30F2N4O.FH.H2/c1-19-13-26-24-5-2-3-6-28(24)34-29(26)30(36(19)21-14-20(15-21)17-33)25-8-7-22(16-27(25)32)37-23-9-12-35(18-23)11-4-10-31;;/h2-3,5-8,16,19,23,30,34H,4,9-14,18H2,1H3;2*1H/t19-,23?,30-;;/m1../s1 |
| InChIKey | MYWYWGIMHCYLFO-GIUOUEGWSA-N |
| XLogP | 6.19 |
| TPSA | 55.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.62 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|