C27H32F2N4O — CID 167072744
(1S,3R)-2-but-1-en-2-yl-1-[3-fluoro-5-[1-(3-fluoropropyl)azetidin-3-yl]oxy-2-pyridinyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole (PubChem CID 167072744) has the molecular formula C27H32F2N4O and a molecular weight of 466.58 g/mol. Its IUPAC name is (1S,3R)-2-but-1-en-2-yl-1-[3-fluoro-5-[1-(3-fluoropropyl)azetidin-3-yl]oxy-2-pyridinyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole.
| Compound Name | (1S,3R)-2-but-1-en-2-yl-1-[3-fluoro-5-[1-(3-fluoropropyl)azetidin-3-yl]oxy-2-pyridinyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 167072744 |
| Molecular Formula | C27H32F2N4O |
| Molecular Weight | 466.58 g/mol |
| Exact Mass | 466.25 |
| IUPAC Name | (1S,3R)-2-but-1-en-2-yl-1-[3-fluoro-5-[1-(3-fluoropropyl)azetidin-3-yl]oxy-2-pyridinyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole |
| SMILES | C=C(CC)N1[C@H](c2ncc(OC3CN(CCCF)C3)cc2F)c2[nH]c3ccccc3c2C[C@H]1C |
| InChI | InChI=1S/C27H32F2N4O/c1-4-17(2)33-18(3)12-22-21-8-5-6-9-24(21)31-25(22)27(33)26-23(29)13-19(14-30-26)34-20-15-32(16-20)11-7-10-28/h5-6,8-9,13-14,18,20,27,31H,2,4,7,10-12,15-16H2,1,3H3/t18-,27+/m1/s1 |
| InChIKey | MDDNWDCTBJYHHA-CLYVBNDRSA-N |
| XLogP | 5.38 |
| TPSA | 44.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.58 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|