C25H31FN4O2S — CID 146442407
[(1S,3R)-1-[4-[[1-(3-fluoropropyl)azetidin-3-yl]amino]phenyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methanesulfinic acid (PubChem CID 146442407) has the molecular formula C25H31FN4O2S and a molecular weight of 470.61 g/mol. Its IUPAC name is [(1S,3R)-1-[4-[[1-(3-fluoropropyl)azetidin-3-yl]amino]phenyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methanesulfinic acid.
| Compound Name | [(1S,3R)-1-[4-[[1-(3-fluoropropyl)azetidin-3-yl]amino]phenyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methanesulfinic acid |
|---|---|
| PubChem CID | 146442407 |
| Molecular Formula | C25H31FN4O2S |
| Molecular Weight | 470.61 g/mol |
| Exact Mass | 470.22 |
| IUPAC Name | [(1S,3R)-1-[4-[[1-(3-fluoropropyl)azetidin-3-yl]amino]phenyl]-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methanesulfinic acid |
| SMILES | C[C@@H]1Cc2c([nH]c3ccccc23)[C@H](c2ccc(NC3CN(CCCF)C3)cc2)N1CS(=O)O |
| InChI | InChI=1S/C25H31FN4O2S/c1-17-13-22-21-5-2-3-6-23(21)28-24(22)25(30(17)16-33(31)32)18-7-9-19(10-8-18)27-20-14-29(15-20)12-4-11-26/h2-3,5-10,17,20,25,27-28H,4,11-16H2,1H3,(H,31,32)/t17-,25+/m1/s1 |
| InChIKey | UPVFYDCZMQQTOC-NSYGIPOTSA-N |
| XLogP | 4.14 |
| TPSA | 71.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.61 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|