C26H26F2N2O2 — CID 138643029
ethyl (E)-3-[4-[(1R)-2-but-3-enyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-3,5-difluorophenyl]prop-2-enoate (PubChem CID 138643029) has the molecular formula C26H26F2N2O2 and a molecular weight of 436.50 g/mol. Its IUPAC name is ethyl (E)-3-[4-[(1R)-2-but-3-enyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-3,5-difluorophenyl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[4-[(1R)-2-but-3-enyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-3,5-difluorophenyl]prop-2-enoate |
|---|---|
| PubChem CID | 138643029 |
| Molecular Formula | C26H26F2N2O2 |
| Molecular Weight | 436.50 g/mol |
| Exact Mass | 436.20 |
| IUPAC Name | ethyl (E)-3-[4-[(1R)-2-but-3-enyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-3,5-difluorophenyl]prop-2-enoate |
| SMILES | C=CCCN1CCc2c([nH]c3ccccc23)[C@H]1c1c(F)cc(/C=C/C(=O)OCC)cc1F |
| InChI | InChI=1S/C26H26F2N2O2/c1-3-5-13-30-14-12-19-18-8-6-7-9-22(18)29-25(19)26(30)24-20(27)15-17(16-21(24)28)10-11-23(31)32-4-2/h3,6-11,15-16,26,29H,1,4-5,12-14H2,2H3/b11-10+/t26-/m1/s1 |
| InChIKey | DEYFOPSJKQWHGC-QJASNXPTSA-N |
| XLogP | 5.55 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.50 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|