C26H29IN2O2P2 — CID 155062486
iodo (E)-3-[4-(3-methyl-2-pent-4-enyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl)-3,5-bis(phosphanyl)phenyl]prop-2-enoate (PubChem CID 155062486) has the molecular formula C26H29IN2O2P2 and a molecular weight of 590.38 g/mol. Its IUPAC name is iodo (E)-3-[4-(3-methyl-2-pent-4-enyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl)-3,5-bis(phosphanyl)phenyl]prop-2-enoate.
| Compound Name | iodo (E)-3-[4-(3-methyl-2-pent-4-enyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl)-3,5-bis(phosphanyl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 155062486 |
| Molecular Formula | C26H29IN2O2P2 |
| Molecular Weight | 590.38 g/mol |
| Exact Mass | 590.07 |
| IUPAC Name | iodo (E)-3-[4-(3-methyl-2-pent-4-enyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl)-3,5-bis(phosphanyl)phenyl]prop-2-enoate |
| SMILES | C=CCCCN1C(C)Cc2c([nH]c3ccccc23)C1c1c(P)cc(/C=C/C(=O)OI)cc1P |
| InChI | InChI=1S/C26H29IN2O2P2/c1-3-4-7-12-29-16(2)13-19-18-8-5-6-9-20(18)28-25(19)26(29)24-21(32)14-17(15-22(24)33)10-11-23(30)31-27/h3,5-6,8-11,14-16,26,28H,1,4,7,12-13,32-33H2,2H3/b11-10+ |
| InChIKey | AAUYEYXCYAHLMK-ZHACJKMWSA-N |
| XLogP | 5.38 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.38 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|