C27H30F2N2O — CID 158318589
(E)-4-[3-fluoro-4-[(1R,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-5-methylphenyl]but-3-en-2-one (PubChem CID 158318589) has the molecular formula C27H30F2N2O and a molecular weight of 436.55 g/mol. Its IUPAC name is (E)-4-[3-fluoro-4-[(1R,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-5-methylphenyl]but-3-en-2-one.
| Compound Name | (E)-4-[3-fluoro-4-[(1R,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-5-methylphenyl]but-3-en-2-one |
|---|---|
| PubChem CID | 158318589 |
| Molecular Formula | C27H30F2N2O |
| Molecular Weight | 436.55 g/mol |
| Exact Mass | 436.23 |
| IUPAC Name | (E)-4-[3-fluoro-4-[(1R,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-5-methylphenyl]but-3-en-2-one |
| SMILES | CC(=O)/C=C/c1cc(C)c([C@@H]2c3[nH]c4ccccc4c3C[C@@H](C)N2CC(C)(C)F)c(F)c1 |
| InChI | InChI=1S/C27H30F2N2O/c1-16-12-19(11-10-18(3)32)14-22(28)24(16)26-25-21(20-8-6-7-9-23(20)30-25)13-17(2)31(26)15-27(4,5)29/h6-12,14,17,26,30H,13,15H2,1-5H3/b11-10+/t17-,26-/m1/s1 |
| InChIKey | GOOIPHFVXFHWLF-XWBGKLNQSA-N |
| XLogP | 6.30 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.55 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|