C28H31ClF2N2O2 — CID 146332789
ethyl (E)-4-[3-chloro-5-fluoro-4-[(1R,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenyl]but-3-enoate (PubChem CID 146332789) has the molecular formula C28H31ClF2N2O2 and a molecular weight of 501.02 g/mol. Its IUPAC name is ethyl (E)-4-[3-chloro-5-fluoro-4-[(1R,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenyl]but-3-enoate.
| Compound Name | ethyl (E)-4-[3-chloro-5-fluoro-4-[(1R,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenyl]but-3-enoate |
|---|---|
| PubChem CID | 146332789 |
| Molecular Formula | C28H31ClF2N2O2 |
| Molecular Weight | 501.02 g/mol |
| Exact Mass | 500.20 |
| IUPAC Name | ethyl (E)-4-[3-chloro-5-fluoro-4-[(1R,3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenyl]but-3-enoate |
| SMILES | CCOC(=O)C/C=C/c1cc(F)c([C@@H]2c3[nH]c4ccccc4c3C[C@@H](C)N2CC(C)(C)F)c(Cl)c1 |
| InChI | InChI=1S/C28H31ClF2N2O2/c1-5-35-24(34)12-8-9-18-14-21(29)25(22(30)15-18)27-26-20(19-10-6-7-11-23(19)32-26)13-17(2)33(27)16-28(3,4)31/h6-11,14-15,17,27,32H,5,12-13,16H2,1-4H3/b9-8+/t17-,27-/m1/s1 |
| InChIKey | IPVMPALLGVDZTC-YXYDWDCCSA-N |
| XLogP | 7.01 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.02 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|