C26H27F3N2O — CID 158777831
(E)-4-[3,5-difluoro-4-[6-fluoro-3-methyl-2-(2-methylpropyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenyl]but-3-en-2-one (PubChem CID 158777831) has the molecular formula C26H27F3N2O and a molecular weight of 440.51 g/mol. Its IUPAC name is (E)-4-[3,5-difluoro-4-[6-fluoro-3-methyl-2-(2-methylpropyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenyl]but-3-en-2-one.
| Compound Name | (E)-4-[3,5-difluoro-4-[6-fluoro-3-methyl-2-(2-methylpropyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenyl]but-3-en-2-one |
|---|---|
| PubChem CID | 158777831 |
| Molecular Formula | C26H27F3N2O |
| Molecular Weight | 440.51 g/mol |
| Exact Mass | 440.21 |
| IUPAC Name | (E)-4-[3,5-difluoro-4-[6-fluoro-3-methyl-2-(2-methylpropyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenyl]but-3-en-2-one |
| SMILES | CC(=O)/C=C/c1cc(F)c(C2c3[nH]c4ccc(F)cc4c3CC(C)N2CC(C)C)c(F)c1 |
| InChI | InChI=1S/C26H27F3N2O/c1-14(2)13-31-15(3)9-20-19-12-18(27)7-8-23(19)30-25(20)26(31)24-21(28)10-17(11-22(24)29)6-5-16(4)32/h5-8,10-12,14-15,26,30H,9,13H2,1-4H3/b6-5+ |
| InChIKey | VPRGNQNUSUYSCW-AATRIKPKSA-N |
| XLogP | 6.18 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.51 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|