C22H21F4IN2 — CID 130300773
1-(2,6-difluoro-4-iodophenyl)-6-fluoro-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole (PubChem CID 130300773) has the molecular formula C22H21F4IN2 and a molecular weight of 516.32 g/mol. Its IUPAC name is 1-(2,6-difluoro-4-iodophenyl)-6-fluoro-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole.
| Compound Name | 1-(2,6-difluoro-4-iodophenyl)-6-fluoro-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 130300773 |
| Molecular Formula | C22H21F4IN2 |
| Molecular Weight | 516.32 g/mol |
| Exact Mass | 516.07 |
| IUPAC Name | 1-(2,6-difluoro-4-iodophenyl)-6-fluoro-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole |
| SMILES | CC1Cc2c([nH]c3ccc(F)cc23)C(c2c(F)cc(I)cc2F)N1CC(C)(C)F |
| InChI | InChI=1S/C22H21F4IN2/c1-11-6-15-14-7-12(23)4-5-18(14)28-20(15)21(29(11)10-22(2,3)26)19-16(24)8-13(27)9-17(19)25/h4-5,7-9,11,21,28H,6,10H2,1-3H3 |
| InChIKey | KNYRTKXWTCHXAE-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.32 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|