C31H32F4N2O4S — CID 130300775
2-[3,5-difluoro-4-[6-fluoro-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenoxy]ethyl 4-methylbenzenesulfonate (PubChem CID 130300775) has the molecular formula C31H32F4N2O4S and a molecular weight of 604.67 g/mol. Its IUPAC name is 2-[3,5-difluoro-4-[6-fluoro-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenoxy]ethyl 4-methylbenzenesulfonate.
| Compound Name | 2-[3,5-difluoro-4-[6-fluoro-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenoxy]ethyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 130300775 |
| Molecular Formula | C31H32F4N2O4S |
| Molecular Weight | 604.67 g/mol |
| Exact Mass | 604.20 |
| IUPAC Name | 2-[3,5-difluoro-4-[6-fluoro-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]phenoxy]ethyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCCOc2cc(F)c(C3c4[nH]c5ccc(F)cc5c4CC(C)N3CC(C)(C)F)c(F)c2)cc1 |
| InChI | InChI=1S/C31H32F4N2O4S/c1-18-5-8-22(9-6-18)42(38,39)41-12-11-40-21-15-25(33)28(26(34)16-21)30-29-24(13-19(2)37(30)17-31(3,4)35)23-14-20(32)7-10-27(23)36-29/h5-10,14-16,19,30,36H,11-13,17H2,1-4H3 |
| InChIKey | PFSHZXPDTAAXHH-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 71.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.67 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|