C25H26N2O2 — CID 123915473
methyl 3-[4-(3-methyl-2-prop-2-enyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl)phenyl]prop-2-enoate (PubChem CID 123915473) has the molecular formula C25H26N2O2 and a molecular weight of 386.50 g/mol. Its IUPAC name is methyl 3-[4-(3-methyl-2-prop-2-enyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl)phenyl]prop-2-enoate.
| Compound Name | methyl 3-[4-(3-methyl-2-prop-2-enyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 123915473 |
| Molecular Formula | C25H26N2O2 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | methyl 3-[4-(3-methyl-2-prop-2-enyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl)phenyl]prop-2-enoate |
| SMILES | C=CCN1C(C)Cc2c([nH]c3ccccc23)C1c1ccc(C=CC(=O)OC)cc1 |
| InChI | InChI=1S/C25H26N2O2/c1-4-15-27-17(2)16-21-20-7-5-6-8-22(20)26-24(21)25(27)19-12-9-18(10-13-19)11-14-23(28)29-3/h4-14,17,25-26H,1,15-16H2,2-3H3 |
| InChIKey | VSBWPUJVJUQCLD-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|