C24H28N4 — CID 164561517
N-[4-(2-but-3-enyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl)phenyl]azetidin-3-amine (PubChem CID 164561517) has the molecular formula C24H28N4 and a molecular weight of 372.52 g/mol. Its IUPAC name is N-[4-(2-but-3-enyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl)phenyl]azetidin-3-amine.
| Compound Name | N-[4-(2-but-3-enyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl)phenyl]azetidin-3-amine |
|---|---|
| PubChem CID | 164561517 |
| Molecular Formula | C24H28N4 |
| Molecular Weight | 372.52 g/mol |
| Exact Mass | 372.23 |
| IUPAC Name | N-[4-(2-but-3-enyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl)phenyl]azetidin-3-amine |
| SMILES | C=CCCN1CCc2c([nH]c3ccccc23)C1c1ccc(NC2CNC2)cc1 |
| InChI | InChI=1S/C24H28N4/c1-2-3-13-28-14-12-21-20-6-4-5-7-22(20)27-23(21)24(28)17-8-10-18(11-9-17)26-19-15-25-16-19/h2,4-11,19,24-27H,1,3,12-16H2 |
| InChIKey | ZYVZFDRXIWJPNI-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.52 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|