C18H19N3 — CID 29002297
(1R)-2-methyl-1-(6-methyl-2-pyridinyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole (PubChem CID 29002297) has the molecular formula C18H19N3 and a molecular weight of 277.37 g/mol. Its IUPAC name is (1R)-2-methyl-1-(6-methyl-2-pyridinyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole.
| Compound Name | (1R)-2-methyl-1-(6-methyl-2-pyridinyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 29002297 |
| Molecular Formula | C18H19N3 |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.16 |
| IUPAC Name | (1R)-2-methyl-1-(6-methyl-2-pyridinyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole |
| SMILES | Cc1cccc([C@H]2c3[nH]c4ccccc4c3CCN2C)n1 |
| InChI | InChI=1S/C18H19N3/c1-12-6-5-9-16(19-12)18-17-14(10-11-21(18)2)13-7-3-4-8-15(13)20-17/h3-9,18,20H,10-11H2,1-2H3/t18-/m0/s1 |
| InChIKey | CETPGQQYHXGYKZ-SFHVURJKSA-N |
| XLogP | 3.45 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|