C23H19ClN4O — CID 42217301
(2-chloro-4-pyridinyl)-[(1R)-1-(6-methyl-2-pyridinyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methanone (PubChem CID 42217301) has the molecular formula C23H19ClN4O and a molecular weight of 402.89 g/mol. Its IUPAC name is (2-chloro-4-pyridinyl)-[(1R)-1-(6-methyl-2-pyridinyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methanone.
| Compound Name | (2-chloro-4-pyridinyl)-[(1R)-1-(6-methyl-2-pyridinyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methanone |
|---|---|
| PubChem CID | 42217301 |
| Molecular Formula | C23H19ClN4O |
| Molecular Weight | 402.89 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | (2-chloro-4-pyridinyl)-[(1R)-1-(6-methyl-2-pyridinyl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methanone |
| SMILES | Cc1cccc([C@H]2c3[nH]c4ccccc4c3CCN2C(=O)c2ccnc(Cl)c2)n1 |
| InChI | InChI=1S/C23H19ClN4O/c1-14-5-4-8-19(26-14)22-21-17(16-6-2-3-7-18(16)27-21)10-12-28(22)23(29)15-9-11-25-20(24)13-15/h2-9,11,13,22,27H,10,12H2,1H3/t22-/m0/s1 |
| InChIKey | HOCCLOOCDDBDBD-QFIPXVFZSA-N |
| XLogP | 4.71 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.89 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|