C18H16Cl2N2 — CID 143848673
1-(2,3-dichlorophenyl)-2-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole (PubChem CID 143848673) has the molecular formula C18H16Cl2N2 and a molecular weight of 331.25 g/mol. Its IUPAC name is 1-(2,3-dichlorophenyl)-2-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole.
| Compound Name | 1-(2,3-dichlorophenyl)-2-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 143848673 |
| Molecular Formula | C18H16Cl2N2 |
| Molecular Weight | 331.25 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | 1-(2,3-dichlorophenyl)-2-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indole |
| SMILES | CN1CCc2c([nH]c3ccccc23)C1c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C18H16Cl2N2/c1-22-10-9-12-11-5-2-3-8-15(11)21-17(12)18(22)13-6-4-7-14(19)16(13)20/h2-8,18,21H,9-10H2,1H3 |
| InChIKey | ADIFHWFLIAXTDR-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.25 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|