C23H27N3O2 — CID 139446491
4-[4-[(1S,3S)-6-methoxy-3-methyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl]phenyl]morpholine (PubChem CID 139446491) has the molecular formula C23H27N3O2 and a molecular weight of 377.49 g/mol. Its IUPAC name is 4-[4-[(1S,3S)-6-methoxy-3-methyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl]phenyl]morpholine.
| Compound Name | 4-[4-[(1S,3S)-6-methoxy-3-methyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl]phenyl]morpholine |
|---|---|
| PubChem CID | 139446491 |
| Molecular Formula | C23H27N3O2 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.21 |
| IUPAC Name | 4-[4-[(1S,3S)-6-methoxy-3-methyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indol-1-yl]phenyl]morpholine |
| SMILES | COc1ccc2[nH]c3c(c2c1)C[C@H](C)N[C@H]3c1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C23H27N3O2/c1-15-13-20-19-14-18(27-2)7-8-21(19)25-23(20)22(24-15)16-3-5-17(6-4-16)26-9-11-28-12-10-26/h3-8,14-15,22,24-25H,9-13H2,1-2H3/t15-,22-/m0/s1 |
| InChIKey | QYRWJNZEVJGSBW-NYHFZMIOSA-N |
| XLogP | 3.64 |
| TPSA | 49.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|