C22H28N2O2 — CID 163823891
4-[4-[(3S)-7-methoxy-3,6-dimethyl-1,2,3,4-tetrahydroisoquinolin-1-yl]phenyl]morpholine (PubChem CID 163823891) has the molecular formula C22H28N2O2 and a molecular weight of 352.48 g/mol. Its IUPAC name is 4-[4-[(3S)-7-methoxy-3,6-dimethyl-1,2,3,4-tetrahydroisoquinolin-1-yl]phenyl]morpholine.
| Compound Name | 4-[4-[(3S)-7-methoxy-3,6-dimethyl-1,2,3,4-tetrahydroisoquinolin-1-yl]phenyl]morpholine |
|---|---|
| PubChem CID | 163823891 |
| Molecular Formula | C22H28N2O2 |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | 4-[4-[(3S)-7-methoxy-3,6-dimethyl-1,2,3,4-tetrahydroisoquinolin-1-yl]phenyl]morpholine |
| SMILES | COc1cc2c(cc1C)C[C@H](C)NC2c1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C22H28N2O2/c1-15-12-18-13-16(2)23-22(20(18)14-21(15)25-3)17-4-6-19(7-5-17)24-8-10-26-11-9-24/h4-7,12,14,16,22-23H,8-11,13H2,1-3H3/t16-,22?/m0/s1 |
| InChIKey | FAZFOUVQMQOPBD-CISYCMJJSA-N |
| XLogP | 3.46 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|