C12H17NO — CID 64687418
6-methoxy-1,3-dimethyl-1,2,3,4-tetrahydroisoquinoline (PubChem CID 64687418) has the molecular formula C12H17NO and a molecular weight of 191.27 g/mol. Its IUPAC name is 6-methoxy-1,3-dimethyl-1,2,3,4-tetrahydroisoquinoline.
| Compound Name | 6-methoxy-1,3-dimethyl-1,2,3,4-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 64687418 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | 6-methoxy-1,3-dimethyl-1,2,3,4-tetrahydroisoquinoline |
| SMILES | COc1ccc2c(c1)CC(C)NC2C |
| InChI | InChI=1S/C12H17NO/c1-8-6-10-7-11(14-3)4-5-12(10)9(2)13-8/h4-5,7-9,13H,6H2,1-3H3 |
| InChIKey | WSGQMOPDSPIBDB-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |