C13H18INO3 — CID 19610257
methyl 7-methoxy-1-methyl-1,2,3,4-tetrahydroisoquinoline-3-carboxylate;hydroiodide (PubChem CID 19610257) has the molecular formula C13H18INO3 and a molecular weight of 363.20 g/mol. Its IUPAC name is methyl 7-methoxy-1-methyl-1,2,3,4-tetrahydroisoquinoline-3-carboxylate;hydroiodide.
| Compound Name | methyl 7-methoxy-1-methyl-1,2,3,4-tetrahydroisoquinoline-3-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 19610257 |
| Molecular Formula | C13H18INO3 |
| Molecular Weight | 363.20 g/mol |
| Exact Mass | 363.03 |
| IUPAC Name | methyl 7-methoxy-1-methyl-1,2,3,4-tetrahydroisoquinoline-3-carboxylate;hydroiodide |
| SMILES | COC(=O)C1Cc2ccc(OC)cc2C(C)N1.I |
| InChI | InChI=1S/C13H17NO3.HI/c1-8-11-7-10(16-2)5-4-9(11)6-12(14-8)13(15)17-3;/h4-5,7-8,12,14H,6H2,1-3H3;1H |
| InChIKey | QQLHWKFPMMTLGS-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.20 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|