6,7-dimethoxy-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid

C12H15NO4 — CID 3160572

IUPAC6,7-dimethoxy-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid
SMILESCOc1cc2c(cc1OC)CC(C(=O)O)NC2
InChIInChI=1S/C12H15NO4/c1-16-10-4-7-3-9(12(14)15)13-6-8(7)5-11(10)17-2/h4-5,9,13H,3,6H2,1-2H3,(H,14,15)
InChIKeyBWYXEHBJIMGDEB-UHFFFAOYSA-N
MW237.25 g/mol
LogP0.80
Rot. Bonds3

About 6,7-dimethoxy-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid

6,7-dimethoxy-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid (PubChem CID 3160572) has the molecular formula C12H15NO4 and a molecular weight of 237.25 g/mol. Its IUPAC name is 6,7-dimethoxy-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid.

Molecular Properties

Compound Name6,7-dimethoxy-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid
PubChem CID3160572
Molecular FormulaC12H15NO4
Molecular Weight237.25 g/mol
Exact Mass237.10
IUPAC Name6,7-dimethoxy-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid
SMILESCOc1cc2c(cc1OC)CC(C(=O)O)NC2
InChIInChI=1S/C12H15NO4/c1-16-10-4-7-3-9(12(14)15)13-6-8(7)5-11(10)17-2/h4-5,9,13H,3,6H2,1-2H3,(H,14,15)
InChIKeyBWYXEHBJIMGDEB-UHFFFAOYSA-N
XLogP0.80
TPSA67.79 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500237.25
LogP ≤ 50.80
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 6,7-dimethoxy-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6,7-dimethoxy-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid?
The IUPAC name of 6,7-dimethoxy-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid (CID 3160572) is 6,7-dimethoxy-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid.
What is the SMILES notation for 6,7-dimethoxy-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid?
The canonical SMILES for 6,7-dimethoxy-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid is COc1cc2c(cc1OC)CC(C(=O)O)NC2.
What is the InChIKey of 6,7-dimethoxy-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid?
The InChIKey is BWYXEHBJIMGDEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO4/c1-16-10-4-7-3-9(12(14)15)13-6-8(7)5-11(10)17-2/h4-5,9,13H,3,6H2,1-2H3,(H,14,15).
What are the key properties of 6,7-dimethoxy-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid?
6,7-dimethoxy-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid has a molecular weight of 237.25 g/mol, XLogP of 0.80, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-dimethoxy-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid is sourced from PubChem (CID 3160572), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).