C14H18O — CID 68524779
7-methoxy-2,3,4,4a,9,9a-hexahydro-1H-fluorene (PubChem CID 68524779) has the molecular formula C14H18O and a molecular weight of 202.30 g/mol. Its IUPAC name is 7-methoxy-2,3,4,4a,9,9a-hexahydro-1H-fluorene.
| Compound Name | 7-methoxy-2,3,4,4a,9,9a-hexahydro-1H-fluorene |
|---|---|
| PubChem CID | 68524779 |
| Molecular Formula | C14H18O |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.14 |
| IUPAC Name | 7-methoxy-2,3,4,4a,9,9a-hexahydro-1H-fluorene |
| SMILES | COc1ccc2c(c1)CC1CCCCC21 |
| InChI | InChI=1S/C14H18O/c1-15-12-6-7-14-11(9-12)8-10-4-2-3-5-13(10)14/h6-7,9-10,13H,2-5,8H2,1H3 |
| InChIKey | KWNQDPATGIWMJM-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |