C20H29NO2 — CID 154108346
2-(5,6,7,8,8a,9-hexahydro-4bH-fluoren-2-yloxy)heptanamide (PubChem CID 154108346) has the molecular formula C20H29NO2 and a molecular weight of 315.46 g/mol. Its IUPAC name is 2-(5,6,7,8,8a,9-hexahydro-4bH-fluoren-2-yloxy)heptanamide.
| Compound Name | 2-(5,6,7,8,8a,9-hexahydro-4bH-fluoren-2-yloxy)heptanamide |
|---|---|
| PubChem CID | 154108346 |
| Molecular Formula | C20H29NO2 |
| Molecular Weight | 315.46 g/mol |
| Exact Mass | 315.22 |
| IUPAC Name | 2-(5,6,7,8,8a,9-hexahydro-4bH-fluoren-2-yloxy)heptanamide |
| SMILES | CCCCCC(Oc1ccc2c(c1)CC1CCCCC21)C(N)=O |
| InChI | InChI=1S/C20H29NO2/c1-2-3-4-9-19(20(21)22)23-16-10-11-18-15(13-16)12-14-7-5-6-8-17(14)18/h10-11,13-14,17,19H,2-9,12H2,1H3,(H2,21,22) |
| InChIKey | DTXFOLUBKLKTRZ-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.46 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|