C17H24O3 — CID 83038168
ethyl 2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)pentanoate (PubChem CID 83038168) has the molecular formula C17H24O3 and a molecular weight of 276.38 g/mol. Its IUPAC name is ethyl 2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)pentanoate.
| Compound Name | ethyl 2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)pentanoate |
|---|---|
| PubChem CID | 83038168 |
| Molecular Formula | C17H24O3 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | ethyl 2-(5,6,7,8-tetrahydronaphthalen-2-yloxy)pentanoate |
| SMILES | CCCC(Oc1ccc2c(c1)CCCC2)C(=O)OCC |
| InChI | InChI=1S/C17H24O3/c1-3-7-16(17(18)19-4-2)20-15-11-10-13-8-5-6-9-14(13)12-15/h10-12,16H,3-9H2,1-2H3 |
| InChIKey | XRKOTMCLLNRYQE-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |