2-ethoxy-4-(5,6,7,8-tetrahydronaphthalen-2-yloxy)butanoic acid

C16H22O4 — CID 63075394

IUPAC2-ethoxy-4-(5,6,7,8-tetrahydronaphthalen-2-yloxy)butanoic acid
SMILESCCOC(CCOc1ccc2c(c1)CCCC2)C(=O)O
InChIInChI=1S/C16H22O4/c1-2-19-15(16(17)18)9-10-20-14-8-7-12-5-3-4-6-13(12)11-14/h7-8,11,15H,2-6,9-10H2,1H3,(H,17,18)
InChIKeyOKJFDBDYSKWBOB-UHFFFAOYSA-N
MW278.35 g/mol
LogP2.82
Rot. Bonds7

About 2-ethoxy-4-(5,6,7,8-tetrahydronaphthalen-2-yloxy)butanoic acid

2-ethoxy-4-(5,6,7,8-tetrahydronaphthalen-2-yloxy)butanoic acid (PubChem CID 63075394) has the molecular formula C16H22O4 and a molecular weight of 278.35 g/mol. Its IUPAC name is 2-ethoxy-4-(5,6,7,8-tetrahydronaphthalen-2-yloxy)butanoic acid.

Molecular Properties

Compound Name2-ethoxy-4-(5,6,7,8-tetrahydronaphthalen-2-yloxy)butanoic acid
PubChem CID63075394
Molecular FormulaC16H22O4
Molecular Weight278.35 g/mol
Exact Mass278.15
IUPAC Name2-ethoxy-4-(5,6,7,8-tetrahydronaphthalen-2-yloxy)butanoic acid
SMILESCCOC(CCOc1ccc2c(c1)CCCC2)C(=O)O
InChIInChI=1S/C16H22O4/c1-2-19-15(16(17)18)9-10-20-14-8-7-12-5-3-4-6-13(12)11-14/h7-8,11,15H,2-6,9-10H2,1H3,(H,17,18)
InChIKeyOKJFDBDYSKWBOB-UHFFFAOYSA-N
XLogP2.82
TPSA55.76 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds7
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500278.35
LogP ≤ 52.82
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-ethoxy-4-(5,6,7,8-tetrahydronaphthalen-2-yloxy)butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-ethoxy-4-(5,6,7,8-tetrahydronaphthalen-2-yloxy)butanoic acid?
The IUPAC name of 2-ethoxy-4-(5,6,7,8-tetrahydronaphthalen-2-yloxy)butanoic acid (CID 63075394) is 2-ethoxy-4-(5,6,7,8-tetrahydronaphthalen-2-yloxy)butanoic acid.
What is the SMILES notation for 2-ethoxy-4-(5,6,7,8-tetrahydronaphthalen-2-yloxy)butanoic acid?
The canonical SMILES for 2-ethoxy-4-(5,6,7,8-tetrahydronaphthalen-2-yloxy)butanoic acid is CCOC(CCOc1ccc2c(c1)CCCC2)C(=O)O.
What is the InChIKey of 2-ethoxy-4-(5,6,7,8-tetrahydronaphthalen-2-yloxy)butanoic acid?
The InChIKey is OKJFDBDYSKWBOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22O4/c1-2-19-15(16(17)18)9-10-20-14-8-7-12-5-3-4-6-13(12)11-14/h7-8,11,15H,2-6,9-10H2,1H3,(H,17,18).
What are the key properties of 2-ethoxy-4-(5,6,7,8-tetrahydronaphthalen-2-yloxy)butanoic acid?
2-ethoxy-4-(5,6,7,8-tetrahydronaphthalen-2-yloxy)butanoic acid has a molecular weight of 278.35 g/mol, XLogP of 2.82, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxy-4-(5,6,7,8-tetrahydronaphthalen-2-yloxy)butanoic acid is sourced from PubChem (CID 63075394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).