3-(2,3-dihydro-1H-inden-5-yloxy)-2-ethoxypropanoic acid

C14H18O4 — CID 63072782

IUPAC3-(2,3-dihydro-1H-inden-5-yloxy)-2-ethoxypropanoic acid
SMILESCCOC(COc1ccc2c(c1)CCC2)C(=O)O
InChIInChI=1S/C14H18O4/c1-2-17-13(14(15)16)9-18-12-7-6-10-4-3-5-11(10)8-12/h6-8,13H,2-5,9H2,1H3,(H,15,16)
InChIKeyQKCVIDUDJLQSSO-UHFFFAOYSA-N
MW250.29 g/mol
LogP2.04
Rot. Bonds6

About 3-(2,3-dihydro-1H-inden-5-yloxy)-2-ethoxypropanoic acid

3-(2,3-dihydro-1H-inden-5-yloxy)-2-ethoxypropanoic acid (PubChem CID 63072782) has the molecular formula C14H18O4 and a molecular weight of 250.29 g/mol. Its IUPAC name is 3-(2,3-dihydro-1H-inden-5-yloxy)-2-ethoxypropanoic acid.

Molecular Properties

Compound Name3-(2,3-dihydro-1H-inden-5-yloxy)-2-ethoxypropanoic acid
PubChem CID63072782
Molecular FormulaC14H18O4
Molecular Weight250.29 g/mol
Exact Mass250.12
IUPAC Name3-(2,3-dihydro-1H-inden-5-yloxy)-2-ethoxypropanoic acid
SMILESCCOC(COc1ccc2c(c1)CCC2)C(=O)O
InChIInChI=1S/C14H18O4/c1-2-17-13(14(15)16)9-18-12-7-6-10-4-3-5-11(10)8-12/h6-8,13H,2-5,9H2,1H3,(H,15,16)
InChIKeyQKCVIDUDJLQSSO-UHFFFAOYSA-N
XLogP2.04
TPSA55.76 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500250.29
LogP ≤ 52.04
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 3-(2,3-dihydro-1H-inden-5-yloxy)-2-ethoxypropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(2,3-dihydro-1H-inden-5-yloxy)-2-ethoxypropanoic acid?
The IUPAC name of 3-(2,3-dihydro-1H-inden-5-yloxy)-2-ethoxypropanoic acid (CID 63072782) is 3-(2,3-dihydro-1H-inden-5-yloxy)-2-ethoxypropanoic acid.
What is the SMILES notation for 3-(2,3-dihydro-1H-inden-5-yloxy)-2-ethoxypropanoic acid?
The canonical SMILES for 3-(2,3-dihydro-1H-inden-5-yloxy)-2-ethoxypropanoic acid is CCOC(COc1ccc2c(c1)CCC2)C(=O)O.
What is the InChIKey of 3-(2,3-dihydro-1H-inden-5-yloxy)-2-ethoxypropanoic acid?
The InChIKey is QKCVIDUDJLQSSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18O4/c1-2-17-13(14(15)16)9-18-12-7-6-10-4-3-5-11(10)8-12/h6-8,13H,2-5,9H2,1H3,(H,15,16).
What are the key properties of 3-(2,3-dihydro-1H-inden-5-yloxy)-2-ethoxypropanoic acid?
3-(2,3-dihydro-1H-inden-5-yloxy)-2-ethoxypropanoic acid has a molecular weight of 250.29 g/mol, XLogP of 2.04, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,3-dihydro-1H-inden-5-yloxy)-2-ethoxypropanoic acid is sourced from PubChem (CID 63072782), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).