C15H20O4 — CID 55180899
4-(2,3-dihydro-1H-inden-5-yloxy)-2-ethoxybutanoic acid (PubChem CID 55180899) has the molecular formula C15H20O4 and a molecular weight of 264.32 g/mol. Its IUPAC name is 4-(2,3-dihydro-1H-inden-5-yloxy)-2-ethoxybutanoic acid.
| Compound Name | 4-(2,3-dihydro-1H-inden-5-yloxy)-2-ethoxybutanoic acid |
|---|---|
| PubChem CID | 55180899 |
| Molecular Formula | C15H20O4 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | 4-(2,3-dihydro-1H-inden-5-yloxy)-2-ethoxybutanoic acid |
| SMILES | CCOC(CCOc1ccc2c(c1)CCC2)C(=O)O |
| InChI | InChI=1S/C15H20O4/c1-2-18-14(15(16)17)8-9-19-13-7-6-11-4-3-5-12(11)10-13/h6-7,10,14H,2-5,8-9H2,1H3,(H,16,17) |
| InChIKey | OPZFGSNZZTUEDN-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |