2-[2-(2,3-dihydro-1H-inden-5-yloxy)ethyl]-3-methylbutanoic acid

C16H22O3 — CID 112509249

IUPAC2-[2-(2,3-dihydro-1H-inden-5-yloxy)ethyl]-3-methylbutanoic acid
SMILESCC(C)C(CCOc1ccc2c(c1)CCC2)C(=O)O
InChIInChI=1S/C16H22O3/c1-11(2)15(16(17)18)8-9-19-14-7-6-12-4-3-5-13(12)10-14/h6-7,10-11,15H,3-5,8-9H2,1-2H3,(H,17,18)
InChIKeyCYGZZVCQQOCNJJ-UHFFFAOYSA-N
MW262.35 g/mol
LogP3.30
Rot. Bonds6

About 2-[2-(2,3-dihydro-1H-inden-5-yloxy)ethyl]-3-methylbutanoic acid

2-[2-(2,3-dihydro-1H-inden-5-yloxy)ethyl]-3-methylbutanoic acid (PubChem CID 112509249) has the molecular formula C16H22O3 and a molecular weight of 262.35 g/mol. Its IUPAC name is 2-[2-(2,3-dihydro-1H-inden-5-yloxy)ethyl]-3-methylbutanoic acid.

Molecular Properties

Compound Name2-[2-(2,3-dihydro-1H-inden-5-yloxy)ethyl]-3-methylbutanoic acid
PubChem CID112509249
Molecular FormulaC16H22O3
Molecular Weight262.35 g/mol
Exact Mass262.16
IUPAC Name2-[2-(2,3-dihydro-1H-inden-5-yloxy)ethyl]-3-methylbutanoic acid
SMILESCC(C)C(CCOc1ccc2c(c1)CCC2)C(=O)O
InChIInChI=1S/C16H22O3/c1-11(2)15(16(17)18)8-9-19-14-7-6-12-4-3-5-13(12)10-14/h6-7,10-11,15H,3-5,8-9H2,1-2H3,(H,17,18)
InChIKeyCYGZZVCQQOCNJJ-UHFFFAOYSA-N
XLogP3.30
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds6
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500262.35
LogP ≤ 53.30
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 2-[2-(2,3-dihydro-1H-inden-5-yloxy)ethyl]-3-methylbutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[2-(2,3-dihydro-1H-inden-5-yloxy)ethyl]-3-methylbutanoic acid?
The IUPAC name of 2-[2-(2,3-dihydro-1H-inden-5-yloxy)ethyl]-3-methylbutanoic acid (CID 112509249) is 2-[2-(2,3-dihydro-1H-inden-5-yloxy)ethyl]-3-methylbutanoic acid.
What is the SMILES notation for 2-[2-(2,3-dihydro-1H-inden-5-yloxy)ethyl]-3-methylbutanoic acid?
The canonical SMILES for 2-[2-(2,3-dihydro-1H-inden-5-yloxy)ethyl]-3-methylbutanoic acid is CC(C)C(CCOc1ccc2c(c1)CCC2)C(=O)O.
What is the InChIKey of 2-[2-(2,3-dihydro-1H-inden-5-yloxy)ethyl]-3-methylbutanoic acid?
The InChIKey is CYGZZVCQQOCNJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22O3/c1-11(2)15(16(17)18)8-9-19-14-7-6-12-4-3-5-13(12)10-14/h6-7,10-11,15H,3-5,8-9H2,1-2H3,(H,17,18).
What are the key properties of 2-[2-(2,3-dihydro-1H-inden-5-yloxy)ethyl]-3-methylbutanoic acid?
2-[2-(2,3-dihydro-1H-inden-5-yloxy)ethyl]-3-methylbutanoic acid has a molecular weight of 262.35 g/mol, XLogP of 3.30, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(2,3-dihydro-1H-inden-5-yloxy)ethyl]-3-methylbutanoic acid is sourced from PubChem (CID 112509249), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).