C17H23NO — CID 10106525
(1S,9S,17S)-4-methoxy-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5-triene (PubChem CID 10106525) has the molecular formula C17H23NO and a molecular weight of 257.38 g/mol. Its IUPAC name is (1S,9S,17S)-4-methoxy-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5-triene.
| Compound Name | (1S,9S,17S)-4-methoxy-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5-triene |
|---|---|
| PubChem CID | 10106525 |
| Molecular Formula | C17H23NO |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.18 |
| IUPAC Name | (1S,9S,17S)-4-methoxy-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5-triene |
| SMILES | COc1ccc2c(c1)[C@@H]1CCCN3CCC[C@@H](C2)[C@@H]13 |
| InChI | InChI=1S/C17H23NO/c1-19-14-7-6-12-10-13-4-2-8-18-9-3-5-15(17(13)18)16(12)11-14/h6-7,11,13,15,17H,2-5,8-10H2,1H3/t13-,15-,17-/m0/s1 |
| InChIKey | MWYPGRKCRNBBOD-QRTARXTBSA-N |
| XLogP | 3.21 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |