C12H12O2 — CID 81421647
4-methoxy-2,2a,7,7a-tetrahydrocyclobuta[a]inden-1-one (PubChem CID 81421647) has the molecular formula C12H12O2 and a molecular weight of 188.23 g/mol. Its IUPAC name is 4-methoxy-2,2a,7,7a-tetrahydrocyclobuta[a]inden-1-one.
| Compound Name | 4-methoxy-2,2a,7,7a-tetrahydrocyclobuta[a]inden-1-one |
|---|---|
| PubChem CID | 81421647 |
| Molecular Formula | C12H12O2 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.08 |
| IUPAC Name | 4-methoxy-2,2a,7,7a-tetrahydrocyclobuta[a]inden-1-one |
| SMILES | COc1ccc2c(c1)C1CC(=O)C1C2 |
| InChI | InChI=1S/C12H12O2/c1-14-8-3-2-7-4-11-10(6-12(11)13)9(7)5-8/h2-3,5,10-11H,4,6H2,1H3 |
| InChIKey | XBWMMJYNXVCQCR-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |