C13H17NO2S — CID 79368004
6-methoxy-2-methyl-2,3,4,4a,9,9a-hexahydroindeno[2,1-b][1,4]thiazine 1-oxide (PubChem CID 79368004) has the molecular formula C13H17NO2S and a molecular weight of 251.35 g/mol. Its IUPAC name is 6-methoxy-2-methyl-2,3,4,4a,9,9a-hexahydroindeno[2,1-b][1,4]thiazine 1-oxide.
| Compound Name | 6-methoxy-2-methyl-2,3,4,4a,9,9a-hexahydroindeno[2,1-b][1,4]thiazine 1-oxide |
|---|---|
| PubChem CID | 79368004 |
| Molecular Formula | C13H17NO2S |
| Molecular Weight | 251.35 g/mol |
| Exact Mass | 251.10 |
| IUPAC Name | 6-methoxy-2-methyl-2,3,4,4a,9,9a-hexahydroindeno[2,1-b][1,4]thiazine 1-oxide |
| SMILES | COc1ccc2c(c1)C1NCC(C)S(=O)C1C2 |
| InChI | InChI=1S/C13H17NO2S/c1-8-7-14-13-11-6-10(16-2)4-3-9(11)5-12(13)17(8)15/h3-4,6,8,12-14H,5,7H2,1-2H3 |
| InChIKey | JJGQYAZBVABYAS-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.35 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |