C11H14ClNO — CID 116822166
2-(2-chloro-4-methoxyphenyl)-3-methylazetidine (PubChem CID 116822166) has the molecular formula C11H14ClNO and a molecular weight of 211.69 g/mol. Its IUPAC name is 2-(2-chloro-4-methoxyphenyl)-3-methylazetidine.
| Compound Name | 2-(2-chloro-4-methoxyphenyl)-3-methylazetidine |
|---|---|
| PubChem CID | 116822166 |
| Molecular Formula | C11H14ClNO |
| Molecular Weight | 211.69 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | 2-(2-chloro-4-methoxyphenyl)-3-methylazetidine |
| SMILES | COc1ccc(C2NCC2C)c(Cl)c1 |
| InChI | InChI=1S/C11H14ClNO/c1-7-6-13-11(7)9-4-3-8(14-2)5-10(9)12/h3-5,7,11,13H,6H2,1-2H3 |
| InChIKey | ADQBPFGICOJONJ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.69 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |