C14H19NO — CID 58598878
4-ethyl-7-methoxy-1,2,3,3a,4,8b-hexahydroindeno[1,2-c]pyrrole (PubChem CID 58598878) has the molecular formula C14H19NO and a molecular weight of 217.31 g/mol. Its IUPAC name is 4-ethyl-7-methoxy-1,2,3,3a,4,8b-hexahydroindeno[1,2-c]pyrrole.
| Compound Name | 4-ethyl-7-methoxy-1,2,3,3a,4,8b-hexahydroindeno[1,2-c]pyrrole |
|---|---|
| PubChem CID | 58598878 |
| Molecular Formula | C14H19NO |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | 4-ethyl-7-methoxy-1,2,3,3a,4,8b-hexahydroindeno[1,2-c]pyrrole |
| SMILES | CCC1c2ccc(OC)cc2C2CNCC12 |
| InChI | InChI=1S/C14H19NO/c1-3-10-11-5-4-9(16-2)6-12(11)14-8-15-7-13(10)14/h4-6,10,13-15H,3,7-8H2,1-2H3 |
| InChIKey | QZRDDBSWEXEKRJ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |