C23H28O3 — CID 59504470
[(4aR,9S,10S,10aS)-6-methoxy-10-(4-methoxyphenyl)-1,2,3,4,4a,9,10,10a-octahydrophenanthren-9-yl]methanol (PubChem CID 59504470) has the molecular formula C23H28O3 and a molecular weight of 352.47 g/mol. Its IUPAC name is [(4aR,9S,10S,10aS)-6-methoxy-10-(4-methoxyphenyl)-1,2,3,4,4a,9,10,10a-octahydrophenanthren-9-yl]methanol.
| Compound Name | [(4aR,9S,10S,10aS)-6-methoxy-10-(4-methoxyphenyl)-1,2,3,4,4a,9,10,10a-octahydrophenanthren-9-yl]methanol |
|---|---|
| PubChem CID | 59504470 |
| Molecular Formula | C23H28O3 |
| Molecular Weight | 352.47 g/mol |
| Exact Mass | 352.20 |
| IUPAC Name | [(4aR,9S,10S,10aS)-6-methoxy-10-(4-methoxyphenyl)-1,2,3,4,4a,9,10,10a-octahydrophenanthren-9-yl]methanol |
| SMILES | COc1ccc([C@H]2[C@H]3CCCC[C@H]3c3cc(OC)ccc3[C@H]2CO)cc1 |
| InChI | InChI=1S/C23H28O3/c1-25-16-9-7-15(8-10-16)23-20-6-4-3-5-18(20)21-13-17(26-2)11-12-19(21)22(23)14-24/h7-13,18,20,22-24H,3-6,14H2,1-2H3/t18-,20+,22-,23+/m1/s1 |
| InChIKey | UNSAZGURRPCDIH-IYSOMAHNSA-N |
| XLogP | 4.85 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.47 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |