C22H25FO3 — CID 59504421
(4aR,10aS)-10-(3-fluoro-4-methoxyphenyl)-6-methoxy-1,2,3,4,4a,9,10,10a-octahydrophenanthren-9-ol (PubChem CID 59504421) has the molecular formula C22H25FO3 and a molecular weight of 356.44 g/mol. Its IUPAC name is (4aR,10aS)-10-(3-fluoro-4-methoxyphenyl)-6-methoxy-1,2,3,4,4a,9,10,10a-octahydrophenanthren-9-ol.
| Compound Name | (4aR,10aS)-10-(3-fluoro-4-methoxyphenyl)-6-methoxy-1,2,3,4,4a,9,10,10a-octahydrophenanthren-9-ol |
|---|---|
| PubChem CID | 59504421 |
| Molecular Formula | C22H25FO3 |
| Molecular Weight | 356.44 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | (4aR,10aS)-10-(3-fluoro-4-methoxyphenyl)-6-methoxy-1,2,3,4,4a,9,10,10a-octahydrophenanthren-9-ol |
| SMILES | COc1ccc2c(c1)[C@@H]1CCCC[C@@H]1C(c1ccc(OC)c(F)c1)C2O |
| InChI | InChI=1S/C22H25FO3/c1-25-14-8-9-17-18(12-14)15-5-3-4-6-16(15)21(22(17)24)13-7-10-20(26-2)19(23)11-13/h7-12,15-16,21-22,24H,3-6H2,1-2H3/t15-,16+,21?,22?/m1/s1 |
| InChIKey | UCPXSYDOPNOVSR-QHGUSXPKSA-N |
| XLogP | 4.95 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.44 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |